C28H30N4O3S2 — CID 18805658
(5E)-5-[[2-(2-ethylpiperidin-1-yl)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-3-[(4-methoxyphenyl)methyl]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 18805658) has the molecular formula C28H30N4O3S2 and a molecular weight of 534.71 g/mol. Its IUPAC name is (5E)-5-[[2-(2-ethylpiperidin-1-yl)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-3-[(4-methoxyphenyl)methyl]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[2-(2-ethylpiperidin-1-yl)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-3-[(4-methoxyphenyl)methyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18805658 |
| Molecular Formula | C28H30N4O3S2 |
| Molecular Weight | 534.71 g/mol |
| Exact Mass | 534.18 |
| IUPAC Name | (5E)-5-[[2-(2-ethylpiperidin-1-yl)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-3-[(4-methoxyphenyl)methyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCC1CCCCN1c1nc2c(C)cccn2c(=O)c1/C=C1/SC(=S)N(Cc2ccc(OC)cc2)C1=O |
| InChI | InChI=1S/C28H30N4O3S2/c1-4-20-9-5-6-14-30(20)25-22(26(33)31-15-7-8-18(2)24(31)29-25)16-23-27(34)32(28(36)37-23)17-19-10-12-21(35-3)13-11-19/h7-8,10-13,15-16,20H,4-6,9,14,17H2,1-3H3/b23-16+ |
| InChIKey | LYRBNSZTXAWLLF-XQNSMLJCSA-N |
| XLogP | 5.18 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.71 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|