C21H24N4O6S3 — CID 4711049
3-(1,1-dioxothiolan-3-yl)-5-[[2-[2-(2-hydroxyethoxy)ethylamino]-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 4711049) has the molecular formula C21H24N4O6S3 and a molecular weight of 524.65 g/mol. Its IUPAC name is 3-(1,1-dioxothiolan-3-yl)-5-[[2-[2-(2-hydroxyethoxy)ethylamino]-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-(1,1-dioxothiolan-3-yl)-5-[[2-[2-(2-hydroxyethoxy)ethylamino]-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4711049 |
| Molecular Formula | C21H24N4O6S3 |
| Molecular Weight | 524.65 g/mol |
| Exact Mass | 524.09 |
| IUPAC Name | 3-(1,1-dioxothiolan-3-yl)-5-[[2-[2-(2-hydroxyethoxy)ethylamino]-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | Cc1cccn2c(=O)c(C=C3SC(=S)N(C4CCS(=O)(=O)C4)C3=O)c(NCCOCCO)nc12 |
| InChI | InChI=1S/C21H24N4O6S3/c1-13-3-2-6-24-18(13)23-17(22-5-8-31-9-7-26)15(19(24)27)11-16-20(28)25(21(32)33-16)14-4-10-34(29,30)12-14/h2-3,6,11,14,22,26H,4-5,7-10,12H2,1H3 |
| InChIKey | VQUVQOFHKKZJTN-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 130.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.65 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|