C25H29N5O5S2 — CID 3345114
6-[5-[[2-(4-carbamoylpiperidin-1-yl)-7-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid (PubChem CID 3345114) has the molecular formula C25H29N5O5S2 and a molecular weight of 543.67 g/mol. Its IUPAC name is 6-[5-[[2-(4-carbamoylpiperidin-1-yl)-7-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid.
| Compound Name | 6-[5-[[2-(4-carbamoylpiperidin-1-yl)-7-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid |
|---|---|
| PubChem CID | 3345114 |
| Molecular Formula | C25H29N5O5S2 |
| Molecular Weight | 543.67 g/mol |
| Exact Mass | 543.16 |
| IUPAC Name | 6-[5-[[2-(4-carbamoylpiperidin-1-yl)-7-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid |
| SMILES | Cc1ccc2nc(N3CCC(C(N)=O)CC3)c(C=C3SC(=S)N(CCCCCC(=O)O)C3=O)c(=O)n2c1 |
| InChI | InChI=1S/C25H29N5O5S2/c1-15-6-7-19-27-22(28-11-8-16(9-12-28)21(26)33)17(23(34)30(19)14-15)13-18-24(35)29(25(36)37-18)10-4-2-3-5-20(31)32/h6-7,13-14,16H,2-5,8-12H2,1H3,(H2,26,33)(H,31,32) |
| InChIKey | QYEMHONXWLTRAH-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 138.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.67 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|