C24H19Cl2N3O3S2 — CID 18817028
(5E)-3-cyclohexyl-5-[[2-(2,4-dichlorophenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 18817028) has the molecular formula C24H19Cl2N3O3S2 and a molecular weight of 532.47 g/mol. Its IUPAC name is (5E)-3-cyclohexyl-5-[[2-(2,4-dichlorophenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-cyclohexyl-5-[[2-(2,4-dichlorophenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18817028 |
| Molecular Formula | C24H19Cl2N3O3S2 |
| Molecular Weight | 532.47 g/mol |
| Exact Mass | 531.02 |
| IUPAC Name | (5E)-3-cyclohexyl-5-[[2-(2,4-dichlorophenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C\c2c(Oc3ccc(Cl)cc3Cl)nc3ccccn3c2=O)SC(=S)N1C1CCCCC1 |
| InChI | InChI=1S/C24H19Cl2N3O3S2/c25-14-9-10-18(17(26)12-14)32-21-16(22(30)28-11-5-4-8-20(28)27-21)13-19-23(31)29(24(33)34-19)15-6-2-1-3-7-15/h4-5,8-13,15H,1-3,6-7H2/b19-13+ |
| InChIKey | QSVDTVWZHGGLHY-CPNJWEJPSA-N |
| XLogP | 6.33 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.47 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|