C13H9Cl2N2O2S- — CID 8973742
4-chloro-3-[(2Z)-2-[1-(5-chlorothiophen-2-yl)ethylidene]hydrazinyl]benzoate (PubChem CID 8973742) has the molecular formula C13H9Cl2N2O2S- and a molecular weight of 328.20 g/mol. Its IUPAC name is 4-chloro-3-[(2Z)-2-[1-(5-chlorothiophen-2-yl)ethylidene]hydrazinyl]benzoate.
| Compound Name | 4-chloro-3-[(2Z)-2-[1-(5-chlorothiophen-2-yl)ethylidene]hydrazinyl]benzoate |
|---|---|
| PubChem CID | 8973742 |
| Molecular Formula | C13H9Cl2N2O2S- |
| Molecular Weight | 328.20 g/mol |
| Exact Mass | 326.98 |
| IUPAC Name | 4-chloro-3-[(2Z)-2-[1-(5-chlorothiophen-2-yl)ethylidene]hydrazinyl]benzoate |
| SMILES | C/C(=N/Nc1cc(C(=O)[O-])ccc1Cl)c1ccc(Cl)s1 |
| InChI | InChI=1S/C13H10Cl2N2O2S/c1-7(11-4-5-12(15)20-11)16-17-10-6-8(13(18)19)2-3-9(10)14/h2-6,17H,1H3,(H,18,19)/p-1/b16-7- |
| InChIKey | IPSMVANQASISRK-APSNUPSMSA-M |
| XLogP | 3.25 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.20 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|