C7H8ClN3OS — CID 5354251
[(Z)-1-(5-chlorothiophen-2-yl)ethylideneamino]urea (PubChem CID 5354251) has the molecular formula C7H8ClN3OS and a molecular weight of 217.68 g/mol. Its IUPAC name is [(Z)-1-(5-chlorothiophen-2-yl)ethylideneamino]urea.
| Compound Name | [(Z)-1-(5-chlorothiophen-2-yl)ethylideneamino]urea |
|---|---|
| PubChem CID | 5354251 |
| Molecular Formula | C7H8ClN3OS |
| Molecular Weight | 217.68 g/mol |
| Exact Mass | 217.01 |
| IUPAC Name | [(Z)-1-(5-chlorothiophen-2-yl)ethylideneamino]urea |
| SMILES | C/C(=N/NC(N)=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C7H8ClN3OS/c1-4(10-11-7(9)12)5-2-3-6(8)13-5/h2-3H,1H3,(H3,9,11,12)/b10-4- |
| InChIKey | QRVWNCQEOQVZGE-WMZJFQQLSA-N |
| XLogP | 1.79 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.68 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|