C24H26Cl2N4O4S3 — CID 44514810
2-N,5-N-bis[(Z)-1-(5-chlorothiophen-2-yl)ethylideneamino]-3,4-dipropoxythiophene-2,5-dicarboxamide (PubChem CID 44514810) has the molecular formula C24H26Cl2N4O4S3 and a molecular weight of 601.60 g/mol. Its IUPAC name is 2-N,5-N-bis[(Z)-1-(5-chlorothiophen-2-yl)ethylideneamino]-3,4-dipropoxythiophene-2,5-dicarboxamide.
| Compound Name | 2-N,5-N-bis[(Z)-1-(5-chlorothiophen-2-yl)ethylideneamino]-3,4-dipropoxythiophene-2,5-dicarboxamide |
|---|---|
| PubChem CID | 44514810 |
| Molecular Formula | C24H26Cl2N4O4S3 |
| Molecular Weight | 601.60 g/mol |
| Exact Mass | 600.05 |
| IUPAC Name | 2-N,5-N-bis[(Z)-1-(5-chlorothiophen-2-yl)ethylideneamino]-3,4-dipropoxythiophene-2,5-dicarboxamide |
| SMILES | CCCOc1c(C(=O)N/N=C(/C)c2ccc(Cl)s2)sc(C(=O)N/N=C(/C)c2ccc(Cl)s2)c1OCCC |
| InChI | InChI=1S/C24H26Cl2N4O4S3/c1-5-11-33-19-20(34-12-6-2)22(24(32)30-28-14(4)16-8-10-18(26)36-16)37-21(19)23(31)29-27-13(3)15-7-9-17(25)35-15/h7-10H,5-6,11-12H2,1-4H3,(H,29,31)(H,30,32)/b27-13-,28-14- |
| InChIKey | YKTPEJASFLWUTR-JEGUCOMDSA-N |
| XLogP | 7.06 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.60 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|