C18H17ClN4OS2 — CID 6341793
N-[(Z)-1-(5-chlorothiophen-2-yl)ethylideneamino]-4-[(1-methylimidazol-2-yl)sulfanylmethyl]benzamide (PubChem CID 6341793) has the molecular formula C18H17ClN4OS2 and a molecular weight of 404.95 g/mol. Its IUPAC name is N-[(Z)-1-(5-chlorothiophen-2-yl)ethylideneamino]-4-[(1-methylimidazol-2-yl)sulfanylmethyl]benzamide.
| Compound Name | N-[(Z)-1-(5-chlorothiophen-2-yl)ethylideneamino]-4-[(1-methylimidazol-2-yl)sulfanylmethyl]benzamide |
|---|---|
| PubChem CID | 6341793 |
| Molecular Formula | C18H17ClN4OS2 |
| Molecular Weight | 404.95 g/mol |
| Exact Mass | 404.05 |
| IUPAC Name | N-[(Z)-1-(5-chlorothiophen-2-yl)ethylideneamino]-4-[(1-methylimidazol-2-yl)sulfanylmethyl]benzamide |
| SMILES | C/C(=N/NC(=O)c1ccc(CSc2nccn2C)cc1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C18H17ClN4OS2/c1-12(15-7-8-16(19)26-15)21-22-17(24)14-5-3-13(4-6-14)11-25-18-20-9-10-23(18)2/h3-10H,11H2,1-2H3,(H,22,24)/b21-12- |
| InChIKey | YQAMJGIJEZWPLA-MTJSOVHGSA-N |
| XLogP | 4.58 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.95 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|