C20H28N4OS — CID 39082778
4-[(1-methylimidazol-2-yl)sulfanylmethyl]-N-(4-pyrrolidin-1-ylbutyl)benzamide (PubChem CID 39082778) has the molecular formula C20H28N4OS and a molecular weight of 372.54 g/mol. Its IUPAC name is 4-[(1-methylimidazol-2-yl)sulfanylmethyl]-N-(4-pyrrolidin-1-ylbutyl)benzamide.
| Compound Name | 4-[(1-methylimidazol-2-yl)sulfanylmethyl]-N-(4-pyrrolidin-1-ylbutyl)benzamide |
|---|---|
| PubChem CID | 39082778 |
| Molecular Formula | C20H28N4OS |
| Molecular Weight | 372.54 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | 4-[(1-methylimidazol-2-yl)sulfanylmethyl]-N-(4-pyrrolidin-1-ylbutyl)benzamide |
| SMILES | Cn1ccnc1SCc1ccc(C(=O)NCCCCN2CCCC2)cc1 |
| InChI | InChI=1S/C20H28N4OS/c1-23-15-11-22-20(23)26-16-17-6-8-18(9-7-17)19(25)21-10-2-3-12-24-13-4-5-14-24/h6-9,11,15H,2-5,10,12-14,16H2,1H3,(H,21,25) |
| InChIKey | KIDVBVFFCCYTEI-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.54 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|