C15H17ClN3O4- — CID 8973679
4-chloro-3-[2-(1-ethoxycarbonylpiperidin-4-ylidene)hydrazinyl]benzoate (PubChem CID 8973679) has the molecular formula C15H17ClN3O4- and a molecular weight of 338.77 g/mol. Its IUPAC name is 4-chloro-3-[2-(1-ethoxycarbonylpiperidin-4-ylidene)hydrazinyl]benzoate.
| Compound Name | 4-chloro-3-[2-(1-ethoxycarbonylpiperidin-4-ylidene)hydrazinyl]benzoate |
|---|---|
| PubChem CID | 8973679 |
| Molecular Formula | C15H17ClN3O4- |
| Molecular Weight | 338.77 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 4-chloro-3-[2-(1-ethoxycarbonylpiperidin-4-ylidene)hydrazinyl]benzoate |
| SMILES | CCOC(=O)N1CCC(=NNc2cc(C(=O)[O-])ccc2Cl)CC1 |
| InChI | InChI=1S/C15H18ClN3O4/c1-2-23-15(22)19-7-5-11(6-8-19)17-18-13-9-10(14(20)21)3-4-12(13)16/h3-4,9,18H,2,5-8H2,1H3,(H,20,21)/p-1 |
| InChIKey | DMKNZIDKDQKYCL-UHFFFAOYSA-M |
| XLogP | 1.72 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.77 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|