C17H27N5O4S — CID 8900489
ethyl 4-[[5-(diethylsulfamoyl)-2-pyridinyl]hydrazinylidene]piperidine-1-carboxylate (PubChem CID 8900489) has the molecular formula C17H27N5O4S and a molecular weight of 397.50 g/mol. Its IUPAC name is ethyl 4-[[5-(diethylsulfamoyl)-2-pyridinyl]hydrazinylidene]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[5-(diethylsulfamoyl)-2-pyridinyl]hydrazinylidene]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 8900489 |
| Molecular Formula | C17H27N5O4S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | ethyl 4-[[5-(diethylsulfamoyl)-2-pyridinyl]hydrazinylidene]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(=NNc2ccc(S(=O)(=O)N(CC)CC)cn2)CC1 |
| InChI | InChI=1S/C17H27N5O4S/c1-4-22(5-2)27(24,25)15-7-8-16(18-13-15)20-19-14-9-11-21(12-10-14)17(23)26-6-3/h7-8,13H,4-6,9-12H2,1-3H3,(H,18,20) |
| InChIKey | HWFDGQNZSNXZCK-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 104.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|