C22H26N4O3S — CID 41210948
N,N-diethyl-6-[(2Z)-2-[1-(6-methoxynaphthalen-2-yl)ethylidene]hydrazinyl]pyridine-3-sulfonamide (PubChem CID 41210948) has the molecular formula C22H26N4O3S and a molecular weight of 426.54 g/mol. Its IUPAC name is N,N-diethyl-6-[(2Z)-2-[1-(6-methoxynaphthalen-2-yl)ethylidene]hydrazinyl]pyridine-3-sulfonamide.
| Compound Name | N,N-diethyl-6-[(2Z)-2-[1-(6-methoxynaphthalen-2-yl)ethylidene]hydrazinyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 41210948 |
| Molecular Formula | C22H26N4O3S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | N,N-diethyl-6-[(2Z)-2-[1-(6-methoxynaphthalen-2-yl)ethylidene]hydrazinyl]pyridine-3-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(N/N=C(/C)c2ccc3cc(OC)ccc3c2)nc1 |
| InChI | InChI=1S/C22H26N4O3S/c1-5-26(6-2)30(27,28)21-11-12-22(23-15-21)25-24-16(3)17-7-8-19-14-20(29-4)10-9-18(19)13-17/h7-15H,5-6H2,1-4H3,(H,23,25)/b24-16- |
| InChIKey | TWELYTRWTBCAND-JLPGSUDCSA-N |
| XLogP | 4.11 |
| TPSA | 83.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|