C24H36N4O3S — CID 5026433
N,N-diethyl-6-[2-[(4-octoxyphenyl)methylidene]hydrazinyl]pyridine-3-sulfonamide (PubChem CID 5026433) has the molecular formula C24H36N4O3S and a molecular weight of 460.64 g/mol. Its IUPAC name is N,N-diethyl-6-[2-[(4-octoxyphenyl)methylidene]hydrazinyl]pyridine-3-sulfonamide.
| Compound Name | N,N-diethyl-6-[2-[(4-octoxyphenyl)methylidene]hydrazinyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 5026433 |
| Molecular Formula | C24H36N4O3S |
| Molecular Weight | 460.64 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | N,N-diethyl-6-[2-[(4-octoxyphenyl)methylidene]hydrazinyl]pyridine-3-sulfonamide |
| SMILES | CCCCCCCCOc1ccc(C=NNc2ccc(S(=O)(=O)N(CC)CC)cn2)cc1 |
| InChI | InChI=1S/C24H36N4O3S/c1-4-7-8-9-10-11-18-31-22-14-12-21(13-15-22)19-26-27-24-17-16-23(20-25-24)32(29,30)28(5-2)6-3/h12-17,19-20H,4-11,18H2,1-3H3,(H,25,27) |
| InChIKey | VDAWLCGEVVUBLQ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 83.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.64 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|