C25H27F3N4O — CID 3146370
N-[(4-heptoxyphenyl)methylideneamino]-2-phenyl-6-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 3146370) has the molecular formula C25H27F3N4O and a molecular weight of 456.51 g/mol. Its IUPAC name is N-[(4-heptoxyphenyl)methylideneamino]-2-phenyl-6-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | N-[(4-heptoxyphenyl)methylideneamino]-2-phenyl-6-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 3146370 |
| Molecular Formula | C25H27F3N4O |
| Molecular Weight | 456.51 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | N-[(4-heptoxyphenyl)methylideneamino]-2-phenyl-6-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | CCCCCCCOc1ccc(C=NNc2cc(C(F)(F)F)nc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C25H27F3N4O/c1-2-3-4-5-9-16-33-21-14-12-19(13-15-21)18-29-32-23-17-22(25(26,27)28)30-24(31-23)20-10-7-6-8-11-20/h6-8,10-15,17-18H,2-5,9,16H2,1H3,(H,30,31,32) |
| InChIKey | VOODIMZHMWSBJG-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 59.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.51 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|