C21H33N3O6S — CID 42948243
ethyl 3-[[5-(diethylsulfamoyl)-2-ethoxyphenyl]carbamoyl]piperidine-1-carboxylate (PubChem CID 42948243) has the molecular formula C21H33N3O6S and a molecular weight of 455.58 g/mol. Its IUPAC name is ethyl 3-[[5-(diethylsulfamoyl)-2-ethoxyphenyl]carbamoyl]piperidine-1-carboxylate.
| Compound Name | ethyl 3-[[5-(diethylsulfamoyl)-2-ethoxyphenyl]carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 42948243 |
| Molecular Formula | C21H33N3O6S |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | ethyl 3-[[5-(diethylsulfamoyl)-2-ethoxyphenyl]carbamoyl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCCC(C(=O)Nc2cc(S(=O)(=O)N(CC)CC)ccc2OCC)C1 |
| InChI | InChI=1S/C21H33N3O6S/c1-5-24(6-2)31(27,28)17-11-12-19(29-7-3)18(14-17)22-20(25)16-10-9-13-23(15-16)21(26)30-8-4/h11-12,14,16H,5-10,13,15H2,1-4H3,(H,22,25) |
| InChIKey | QJJUVEOOFYQNQY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |