C16H28ClN3O4S — CID 119268072
4-amino-N-[5-(diethylsulfamoyl)-2-ethoxyphenyl]butanamide;hydrochloride (PubChem CID 119268072) has the molecular formula C16H28ClN3O4S and a molecular weight of 393.94 g/mol. Its IUPAC name is 4-amino-N-[5-(diethylsulfamoyl)-2-ethoxyphenyl]butanamide;hydrochloride.
| Compound Name | 4-amino-N-[5-(diethylsulfamoyl)-2-ethoxyphenyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 119268072 |
| Molecular Formula | C16H28ClN3O4S |
| Molecular Weight | 393.94 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | 4-amino-N-[5-(diethylsulfamoyl)-2-ethoxyphenyl]butanamide;hydrochloride |
| SMILES | CCOc1ccc(S(=O)(=O)N(CC)CC)cc1NC(=O)CCCN.Cl |
| InChI | InChI=1S/C16H27N3O4S.ClH/c1-4-19(5-2)24(21,22)13-9-10-15(23-6-3)14(12-13)18-16(20)8-7-11-17;/h9-10,12H,4-8,11,17H2,1-3H3,(H,18,20);1H |
| InChIKey | YVERMSMMMVDQKE-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.94 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |