C21H27FN2O4S2 — CID 24509301
N-[5-(diethylsulfamoyl)-2-ethoxyphenyl]-3-(2-fluorophenyl)sulfanylpropanamide (PubChem CID 24509301) has the molecular formula C21H27FN2O4S2 and a molecular weight of 454.59 g/mol. Its IUPAC name is N-[5-(diethylsulfamoyl)-2-ethoxyphenyl]-3-(2-fluorophenyl)sulfanylpropanamide.
| Compound Name | N-[5-(diethylsulfamoyl)-2-ethoxyphenyl]-3-(2-fluorophenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 24509301 |
| Molecular Formula | C21H27FN2O4S2 |
| Molecular Weight | 454.59 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | N-[5-(diethylsulfamoyl)-2-ethoxyphenyl]-3-(2-fluorophenyl)sulfanylpropanamide |
| SMILES | CCOc1ccc(S(=O)(=O)N(CC)CC)cc1NC(=O)CCSc1ccccc1F |
| InChI | InChI=1S/C21H27FN2O4S2/c1-4-24(5-2)30(26,27)16-11-12-19(28-6-3)18(15-16)23-21(25)13-14-29-20-10-8-7-9-17(20)22/h7-12,15H,4-6,13-14H2,1-3H3,(H,23,25) |
| InChIKey | BCSZOLLCYORPQL-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.59 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |