C14H16ClF3N4O2 — CID 3411911
ethyl 4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]piperidine-1-carboxylate (PubChem CID 3411911) has the molecular formula C14H16ClF3N4O2 and a molecular weight of 364.76 g/mol. Its IUPAC name is ethyl 4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 3411911 |
| Molecular Formula | C14H16ClF3N4O2 |
| Molecular Weight | 364.76 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | ethyl 4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(=NNc2ncc(C(F)(F)F)cc2Cl)CC1 |
| InChI | InChI=1S/C14H16ClF3N4O2/c1-2-24-13(23)22-5-3-10(4-6-22)20-21-12-11(15)7-9(8-19-12)14(16,17)18/h7-8H,2-6H2,1H3,(H,19,21) |
| InChIKey | GJNYMKXUOXFWKA-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 66.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.76 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|