C15H10Cl2F5N3O2 — CID 89278626
5-chloro-2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-N-ethoxy-3,4-difluorobenzamide (PubChem CID 89278626) has the molecular formula C15H10Cl2F5N3O2 and a molecular weight of 430.16 g/mol. Its IUPAC name is 5-chloro-2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-N-ethoxy-3,4-difluorobenzamide.
| Compound Name | 5-chloro-2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-N-ethoxy-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 89278626 |
| Molecular Formula | C15H10Cl2F5N3O2 |
| Molecular Weight | 430.16 g/mol |
| Exact Mass | 429.01 |
| IUPAC Name | 5-chloro-2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-N-ethoxy-3,4-difluorobenzamide |
| SMILES | CCONC(=O)c1cc(Cl)c(F)c(F)c1Nc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C15H10Cl2F5N3O2/c1-2-27-25-14(26)7-4-8(16)10(18)11(19)12(7)24-13-9(17)3-6(5-23-13)15(20,21)22/h3-5H,2H2,1H3,(H,23,24)(H,25,26) |
| InChIKey | QCOKGAATXHAAIZ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.16 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|