C15H10BrClF5N3O3 — CID 162553221
5-bromo-2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-3,4-difluoro-N-(2-hydroxyethoxy)benzamide (PubChem CID 162553221) has the molecular formula C15H10BrClF5N3O3 and a molecular weight of 490.61 g/mol. Its IUPAC name is 5-bromo-2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-3,4-difluoro-N-(2-hydroxyethoxy)benzamide.
| Compound Name | 5-bromo-2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-3,4-difluoro-N-(2-hydroxyethoxy)benzamide |
|---|---|
| PubChem CID | 162553221 |
| Molecular Formula | C15H10BrClF5N3O3 |
| Molecular Weight | 490.61 g/mol |
| Exact Mass | 488.95 |
| IUPAC Name | 5-bromo-2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-3,4-difluoro-N-(2-hydroxyethoxy)benzamide |
| SMILES | O=C(NOCCO)c1cc(Br)c(F)c(F)c1Nc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C15H10BrClF5N3O3/c16-8-4-7(14(27)25-28-2-1-26)12(11(19)10(8)18)24-13-9(17)3-6(5-23-13)15(20,21)22/h3-5,26H,1-2H2,(H,23,24)(H,25,27) |
| InChIKey | ZGANULNRSVXLJQ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.61 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|