C17H15ClF5N3O4 — CID 89277195
5-chloro-N-(2,3-dihydroxypropoxy)-3,4-difluoro-2-[[3-methyl-5-(trifluoromethyl)-2-pyridinyl]amino]benzamide (PubChem CID 89277195) has the molecular formula C17H15ClF5N3O4 and a molecular weight of 455.77 g/mol. Its IUPAC name is 5-chloro-N-(2,3-dihydroxypropoxy)-3,4-difluoro-2-[[3-methyl-5-(trifluoromethyl)-2-pyridinyl]amino]benzamide.
| Compound Name | 5-chloro-N-(2,3-dihydroxypropoxy)-3,4-difluoro-2-[[3-methyl-5-(trifluoromethyl)-2-pyridinyl]amino]benzamide |
|---|---|
| PubChem CID | 89277195 |
| Molecular Formula | C17H15ClF5N3O4 |
| Molecular Weight | 455.77 g/mol |
| Exact Mass | 455.07 |
| IUPAC Name | 5-chloro-N-(2,3-dihydroxypropoxy)-3,4-difluoro-2-[[3-methyl-5-(trifluoromethyl)-2-pyridinyl]amino]benzamide |
| SMILES | Cc1cc(C(F)(F)F)cnc1Nc1c(C(=O)NOCC(O)CO)cc(Cl)c(F)c1F |
| InChI | InChI=1S/C17H15ClF5N3O4/c1-7-2-8(17(21,22)23)4-24-15(7)25-14-10(3-11(18)12(19)13(14)20)16(29)26-30-6-9(28)5-27/h2-4,9,27-28H,5-6H2,1H3,(H,24,25)(H,26,29) |
| InChIKey | ZBFJWPKCKWGJFV-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 103.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.77 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|