C16H16BF2N3O3 — CID 89277371
CID 89277371 (PubChem CID 89277371) has the molecular formula C16H16BF2N3O3 and a molecular weight of 347.13 g/mol.
| Compound Name | CID 89277371 |
|---|---|
| PubChem CID | 89277371 |
| Molecular Formula | C16H16BF2N3O3 |
| Molecular Weight | 347.13 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | — |
| SMILES | [B]c1cc(C(=O)NOCCO)c(Nc2ncc(C)cc2C)c(F)c1F |
| InChI | InChI=1S/C16H16BF2N3O3/c1-8-5-9(2)15(20-7-8)21-14-10(16(24)22-25-4-3-23)6-11(17)12(18)13(14)19/h5-7,23H,3-4H2,1-2H3,(H,20,21)(H,22,24) |
| InChIKey | MMVDZPVJBLOLJP-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.13 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|