C15H13ClF3N3O3 — CID 89277357
2-[(5-chloro-3-methyl-2-pyridinyl)amino]-3,4,5-trifluoro-N-(2-hydroxyethoxy)benzamide (PubChem CID 89277357) has the molecular formula C15H13ClF3N3O3 and a molecular weight of 375.73 g/mol. Its IUPAC name is 2-[(5-chloro-3-methyl-2-pyridinyl)amino]-3,4,5-trifluoro-N-(2-hydroxyethoxy)benzamide.
| Compound Name | 2-[(5-chloro-3-methyl-2-pyridinyl)amino]-3,4,5-trifluoro-N-(2-hydroxyethoxy)benzamide |
|---|---|
| PubChem CID | 89277357 |
| Molecular Formula | C15H13ClF3N3O3 |
| Molecular Weight | 375.73 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | 2-[(5-chloro-3-methyl-2-pyridinyl)amino]-3,4,5-trifluoro-N-(2-hydroxyethoxy)benzamide |
| SMILES | Cc1cc(Cl)cnc1Nc1c(C(=O)NOCCO)cc(F)c(F)c1F |
| InChI | InChI=1S/C15H13ClF3N3O3/c1-7-4-8(16)6-20-14(7)21-13-9(15(24)22-25-3-2-23)5-10(17)11(18)12(13)19/h4-6,23H,2-3H2,1H3,(H,20,21)(H,22,24) |
| InChIKey | QJAHUHMTOYSBRW-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.73 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|