C16H12Cl3FN4O3 — CID 58886667
3-chloro-7-(2,4-dichloroanilino)-8-fluoro-N-(2-hydroxyethoxy)imidazo[1,2-a]pyridine-6-carboxamide (PubChem CID 58886667) has the molecular formula C16H12Cl3FN4O3 and a molecular weight of 433.65 g/mol. Its IUPAC name is 3-chloro-7-(2,4-dichloroanilino)-8-fluoro-N-(2-hydroxyethoxy)imidazo[1,2-a]pyridine-6-carboxamide.
| Compound Name | 3-chloro-7-(2,4-dichloroanilino)-8-fluoro-N-(2-hydroxyethoxy)imidazo[1,2-a]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 58886667 |
| Molecular Formula | C16H12Cl3FN4O3 |
| Molecular Weight | 433.65 g/mol |
| Exact Mass | 432.00 |
| IUPAC Name | 3-chloro-7-(2,4-dichloroanilino)-8-fluoro-N-(2-hydroxyethoxy)imidazo[1,2-a]pyridine-6-carboxamide |
| SMILES | O=C(NOCCO)c1cn2c(Cl)cnc2c(F)c1Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H12Cl3FN4O3/c17-8-1-2-11(10(18)5-8)22-14-9(16(26)23-27-4-3-25)7-24-12(19)6-21-15(24)13(14)20/h1-2,5-7,22,25H,3-4H2,(H,23,26) |
| InChIKey | NWPNIMOHYUWBAW-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 87.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.65 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|