C16H14ClFN4O3 — CID 58760507
8-chloro-7-(2-fluoroanilino)-N-(2-hydroxyethoxy)imidazo[1,2-a]pyridine-6-carboxamide (PubChem CID 58760507) has the molecular formula C16H14ClFN4O3 and a molecular weight of 364.76 g/mol. Its IUPAC name is 8-chloro-7-(2-fluoroanilino)-N-(2-hydroxyethoxy)imidazo[1,2-a]pyridine-6-carboxamide.
| Compound Name | 8-chloro-7-(2-fluoroanilino)-N-(2-hydroxyethoxy)imidazo[1,2-a]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 58760507 |
| Molecular Formula | C16H14ClFN4O3 |
| Molecular Weight | 364.76 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 8-chloro-7-(2-fluoroanilino)-N-(2-hydroxyethoxy)imidazo[1,2-a]pyridine-6-carboxamide |
| SMILES | O=C(NOCCO)c1cn2ccnc2c(Cl)c1Nc1ccccc1F |
| InChI | InChI=1S/C16H14ClFN4O3/c17-13-14(20-12-4-2-1-3-11(12)18)10(16(24)21-25-8-7-23)9-22-6-5-19-15(13)22/h1-6,9,20,23H,7-8H2,(H,21,24) |
| InChIKey | CCEULDNBSVWLLU-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 87.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.76 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|