C18H17ClF2N4O2 — CID 89185454
7-(4-chloro-2-fluoroanilino)-8-fluoro-N-[(2-methylpropan-2-yl)oxy]imidazo[1,2-a]pyridine-6-carboxamide (PubChem CID 89185454) has the molecular formula C18H17ClF2N4O2 and a molecular weight of 394.81 g/mol. Its IUPAC name is 7-(4-chloro-2-fluoroanilino)-8-fluoro-N-[(2-methylpropan-2-yl)oxy]imidazo[1,2-a]pyridine-6-carboxamide.
| Compound Name | 7-(4-chloro-2-fluoroanilino)-8-fluoro-N-[(2-methylpropan-2-yl)oxy]imidazo[1,2-a]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 89185454 |
| Molecular Formula | C18H17ClF2N4O2 |
| Molecular Weight | 394.81 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | 7-(4-chloro-2-fluoroanilino)-8-fluoro-N-[(2-methylpropan-2-yl)oxy]imidazo[1,2-a]pyridine-6-carboxamide |
| SMILES | CC(C)(C)ONC(=O)c1cn2ccnc2c(F)c1Nc1ccc(Cl)cc1F |
| InChI | InChI=1S/C18H17ClF2N4O2/c1-18(2,3)27-24-17(26)11-9-25-7-6-22-16(25)14(21)15(11)23-13-5-4-10(19)8-12(13)20/h4-9,23H,1-3H3,(H,24,26) |
| InChIKey | GSCQATWAKAEKMJ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 67.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.81 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|