C18H17BrCl2N4O3 — CID 89353165
7-(4-bromo-2-chloroanilino)-8-chloro-N-(2-hydroxybutoxy)imidazo[1,2-a]pyridine-6-carboxamide (PubChem CID 89353165) has the molecular formula C18H17BrCl2N4O3 and a molecular weight of 488.17 g/mol. Its IUPAC name is 7-(4-bromo-2-chloroanilino)-8-chloro-N-(2-hydroxybutoxy)imidazo[1,2-a]pyridine-6-carboxamide.
| Compound Name | 7-(4-bromo-2-chloroanilino)-8-chloro-N-(2-hydroxybutoxy)imidazo[1,2-a]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 89353165 |
| Molecular Formula | C18H17BrCl2N4O3 |
| Molecular Weight | 488.17 g/mol |
| Exact Mass | 485.99 |
| IUPAC Name | 7-(4-bromo-2-chloroanilino)-8-chloro-N-(2-hydroxybutoxy)imidazo[1,2-a]pyridine-6-carboxamide |
| SMILES | CCC(O)CONC(=O)c1cn2ccnc2c(Cl)c1Nc1ccc(Br)cc1Cl |
| InChI | InChI=1S/C18H17BrCl2N4O3/c1-2-11(26)9-28-24-18(27)12-8-25-6-5-22-17(25)15(21)16(12)23-14-4-3-10(19)7-13(14)20/h3-8,11,23,26H,2,9H2,1H3,(H,24,27) |
| InChIKey | ATXAKMONIWBPPO-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 87.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.17 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|