C16H14BrCl2N4O6P — CID 58760505
2-[[7-(4-bromo-2-chloroanilino)-8-chloroimidazo[1,2-a]pyridine-6-carbonyl]amino]oxyethyl dihydrogen phosphate (PubChem CID 58760505) has the molecular formula C16H14BrCl2N4O6P and a molecular weight of 540.09 g/mol. Its IUPAC name is 2-[[7-(4-bromo-2-chloroanilino)-8-chloroimidazo[1,2-a]pyridine-6-carbonyl]amino]oxyethyl dihydrogen phosphate.
| Compound Name | 2-[[7-(4-bromo-2-chloroanilino)-8-chloroimidazo[1,2-a]pyridine-6-carbonyl]amino]oxyethyl dihydrogen phosphate |
|---|---|
| PubChem CID | 58760505 |
| Molecular Formula | C16H14BrCl2N4O6P |
| Molecular Weight | 540.09 g/mol |
| Exact Mass | 537.92 |
| IUPAC Name | 2-[[7-(4-bromo-2-chloroanilino)-8-chloroimidazo[1,2-a]pyridine-6-carbonyl]amino]oxyethyl dihydrogen phosphate |
| SMILES | O=C(NOCCOP(=O)(O)O)c1cn2ccnc2c(Cl)c1Nc1ccc(Br)cc1Cl |
| InChI | InChI=1S/C16H14BrCl2N4O6P/c17-9-1-2-12(11(18)7-9)21-14-10(8-23-4-3-20-15(23)13(14)19)16(24)22-28-5-6-29-30(25,26)27/h1-4,7-8,21H,5-6H2,(H,22,24)(H2,25,26,27) |
| InChIKey | HKDXIDOASMRHRZ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 134.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.09 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|