C16H13BCl2N4O3 — CID 163986010
CID 163986010 (PubChem CID 163986010) has the molecular formula C16H13BCl2N4O3 and a molecular weight of 391.02 g/mol.
| Compound Name | CID 163986010 |
|---|---|
| PubChem CID | 163986010 |
| Molecular Formula | C16H13BCl2N4O3 |
| Molecular Weight | 391.02 g/mol |
| Exact Mass | 390.05 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(Nc2c(C(=O)NOCCO)cn3ccnc3c2Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H13BCl2N4O3/c17-9-1-2-12(11(18)7-9)21-14-10(16(25)22-26-6-5-24)8-23-4-3-20-15(23)13(14)19/h1-4,7-8,21,24H,5-6H2,(H,22,25) |
| InChIKey | GXSCXTARUUOJFV-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 87.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.02 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|