C23H27Cl2N5O3 — CID 59991464
8-chloro-7-(2-chloro-4-methylanilino)-N-(2-hydroxyethoxy)-3-(piperidin-1-ylmethyl)imidazo[1,2-a]pyridine-6-carboxamide (PubChem CID 59991464) has the molecular formula C23H27Cl2N5O3 and a molecular weight of 492.41 g/mol. Its IUPAC name is 8-chloro-7-(2-chloro-4-methylanilino)-N-(2-hydroxyethoxy)-3-(piperidin-1-ylmethyl)imidazo[1,2-a]pyridine-6-carboxamide.
| Compound Name | 8-chloro-7-(2-chloro-4-methylanilino)-N-(2-hydroxyethoxy)-3-(piperidin-1-ylmethyl)imidazo[1,2-a]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 59991464 |
| Molecular Formula | C23H27Cl2N5O3 |
| Molecular Weight | 492.41 g/mol |
| Exact Mass | 491.15 |
| IUPAC Name | 8-chloro-7-(2-chloro-4-methylanilino)-N-(2-hydroxyethoxy)-3-(piperidin-1-ylmethyl)imidazo[1,2-a]pyridine-6-carboxamide |
| SMILES | Cc1ccc(Nc2c(C(=O)NOCCO)cn3c(CN4CCCCC4)cnc3c2Cl)c(Cl)c1 |
| InChI | InChI=1S/C23H27Cl2N5O3/c1-15-5-6-19(18(24)11-15)27-21-17(23(32)28-33-10-9-31)14-30-16(12-26-22(30)20(21)25)13-29-7-3-2-4-8-29/h5-6,11-12,14,27,31H,2-4,7-10,13H2,1H3,(H,28,32) |
| InChIKey | RUCRUGGEZPTQBE-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 91.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.41 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|