C27H39ClFN5O2 — CID 143442403
N-(4-aminobutyl)-N-(2-butoxyethyl)-8-chloro-7-(2-fluoro-4-methylanilino)imidazo[1,2-a]pyridine-6-carboxamide;ethane (PubChem CID 143442403) has the molecular formula C27H39ClFN5O2 and a molecular weight of 520.09 g/mol. Its IUPAC name is N-(4-aminobutyl)-N-(2-butoxyethyl)-8-chloro-7-(2-fluoro-4-methylanilino)imidazo[1,2-a]pyridine-6-carboxamide;ethane.
| Compound Name | N-(4-aminobutyl)-N-(2-butoxyethyl)-8-chloro-7-(2-fluoro-4-methylanilino)imidazo[1,2-a]pyridine-6-carboxamide;ethane |
|---|---|
| PubChem CID | 143442403 |
| Molecular Formula | C27H39ClFN5O2 |
| Molecular Weight | 520.09 g/mol |
| Exact Mass | 519.28 |
| IUPAC Name | N-(4-aminobutyl)-N-(2-butoxyethyl)-8-chloro-7-(2-fluoro-4-methylanilino)imidazo[1,2-a]pyridine-6-carboxamide;ethane |
| SMILES | CC.CCCCOCCN(CCCCN)C(=O)c1cn2ccnc2c(Cl)c1Nc1ccc(C)cc1F |
| InChI | InChI=1S/C25H33ClFN5O2.C2H6/c1-3-4-14-34-15-13-31(11-6-5-9-28)25(33)19-17-32-12-10-29-24(32)22(26)23(19)30-21-8-7-18(2)16-20(21)27;1-2/h7-8,10,12,16-17,30H,3-6,9,11,13-15,28H2,1-2H3;1-2H3 |
| InChIKey | TUQDGJJOVRWVPX-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 84.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.09 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|