C16H13BClF2N3O2 — CID 89277132
CID 89277132 (PubChem CID 89277132) has the molecular formula C16H13BClF2N3O2 and a molecular weight of 363.56 g/mol.
| Compound Name | CID 89277132 |
|---|---|
| PubChem CID | 89277132 |
| Molecular Formula | C16H13BClF2N3O2 |
| Molecular Weight | 363.56 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | — |
| SMILES | [B]c1cnc(Nc2c(C(=O)NOCC=C)cc(Cl)c(F)c2F)c(C)c1 |
| InChI | InChI=1S/C16H13BClF2N3O2/c1-3-4-25-23-16(24)10-6-11(18)12(19)13(20)14(10)22-15-8(2)5-9(17)7-21-15/h3,5-7H,1,4H2,2H3,(H,21,22)(H,23,24) |
| InChIKey | YDPXNHRLJPSJPY-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.56 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|