C15H12BClF3N3O4 — CID 89277184
CID 89277184 (PubChem CID 89277184) has the molecular formula C15H12BClF3N3O4 and a molecular weight of 401.54 g/mol.
| Compound Name | CID 89277184 |
|---|---|
| PubChem CID | 89277184 |
| Molecular Formula | C15H12BClF3N3O4 |
| Molecular Weight | 401.54 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | — |
| SMILES | [B]c1cc(F)cnc1Nc1c(C(=O)NOC[C@H](O)CO)cc(Cl)c(F)c1F |
| InChI | InChI=1S/C15H12BClF3N3O4/c16-9-1-6(18)3-21-14(9)22-13-8(2-10(17)11(19)12(13)20)15(26)23-27-5-7(25)4-24/h1-3,7,24-25H,4-5H2,(H,21,22)(H,23,26)/t7-/m1/s1 |
| InChIKey | WXUKWLGCRAKINH-SSDOTTSWSA-N |
| XLogP | 0.70 |
| TPSA | 103.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.54 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|