C16H12ClF6N3O4 — CID 89278452
2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-N-[(2R)-2,3-dihydroxypropoxy]-3,4,5-trifluorobenzamide (PubChem CID 89278452) has the molecular formula C16H12ClF6N3O4 and a molecular weight of 459.73 g/mol. Its IUPAC name is 2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-N-[(2R)-2,3-dihydroxypropoxy]-3,4,5-trifluorobenzamide.
| Compound Name | 2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-N-[(2R)-2,3-dihydroxypropoxy]-3,4,5-trifluorobenzamide |
|---|---|
| PubChem CID | 89278452 |
| Molecular Formula | C16H12ClF6N3O4 |
| Molecular Weight | 459.73 g/mol |
| Exact Mass | 459.04 |
| IUPAC Name | 2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-N-[(2R)-2,3-dihydroxypropoxy]-3,4,5-trifluorobenzamide |
| SMILES | O=C(NOC[C@H](O)CO)c1cc(F)c(F)c(F)c1Nc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C16H12ClF6N3O4/c17-9-1-6(16(21,22)23)3-24-14(9)25-13-8(2-10(18)11(19)12(13)20)15(29)26-30-5-7(28)4-27/h1-3,7,27-28H,4-5H2,(H,24,25)(H,26,29)/t7-/m1/s1 |
| InChIKey | DCCCDLCMRRKZFG-SSDOTTSWSA-N |
| XLogP | 2.93 |
| TPSA | 103.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.73 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|