C16H13Cl2F2N3O2 — CID 24852482
N-(cyclopropylmethoxy)-2-[(3,5-dichloro-2-pyridinyl)amino]-3,4-difluorobenzamide (PubChem CID 24852482) has the molecular formula C16H13Cl2F2N3O2 and a molecular weight of 388.20 g/mol. Its IUPAC name is N-(cyclopropylmethoxy)-2-[(3,5-dichloro-2-pyridinyl)amino]-3,4-difluorobenzamide.
| Compound Name | N-(cyclopropylmethoxy)-2-[(3,5-dichloro-2-pyridinyl)amino]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 24852482 |
| Molecular Formula | C16H13Cl2F2N3O2 |
| Molecular Weight | 388.20 g/mol |
| Exact Mass | 387.04 |
| IUPAC Name | N-(cyclopropylmethoxy)-2-[(3,5-dichloro-2-pyridinyl)amino]-3,4-difluorobenzamide |
| SMILES | O=C(NOCC1CC1)c1ccc(F)c(F)c1Nc1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C16H13Cl2F2N3O2/c17-9-5-11(18)15(21-6-9)22-14-10(3-4-12(19)13(14)20)16(24)23-25-7-8-1-2-8/h3-6,8H,1-2,7H2,(H,21,22)(H,23,24) |
| InChIKey | BQODNTWDPVHKFQ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.20 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|