C16H14F3N3O2 — CID 89278624
N-(cyclopropylmethoxy)-3,4-difluoro-2-[(5-fluoro-3-pyridinyl)amino]benzamide (PubChem CID 89278624) has the molecular formula C16H14F3N3O2 and a molecular weight of 337.30 g/mol. Its IUPAC name is N-(cyclopropylmethoxy)-3,4-difluoro-2-[(5-fluoro-3-pyridinyl)amino]benzamide.
| Compound Name | N-(cyclopropylmethoxy)-3,4-difluoro-2-[(5-fluoro-3-pyridinyl)amino]benzamide |
|---|---|
| PubChem CID | 89278624 |
| Molecular Formula | C16H14F3N3O2 |
| Molecular Weight | 337.30 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | N-(cyclopropylmethoxy)-3,4-difluoro-2-[(5-fluoro-3-pyridinyl)amino]benzamide |
| SMILES | O=C(NOCC1CC1)c1ccc(F)c(F)c1Nc1cncc(F)c1 |
| InChI | InChI=1S/C16H14F3N3O2/c17-10-5-11(7-20-6-10)21-15-12(3-4-13(18)14(15)19)16(23)22-24-8-9-1-2-9/h3-7,9,21H,1-2,8H2,(H,22,23) |
| InChIKey | QEQKOGBYVSJLRX-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.30 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|