C30H28F2IN5O4S — CID 142653793
5-[bis(pyridin-3-ylmethyl)sulfamoyl]-N-(cyclopropylmethoxy)-3,4-difluoro-2-(4-iodo-3-methylanilino)benzamide (PubChem CID 142653793) has the molecular formula C30H28F2IN5O4S and a molecular weight of 719.55 g/mol. Its IUPAC name is 5-[bis(pyridin-3-ylmethyl)sulfamoyl]-N-(cyclopropylmethoxy)-3,4-difluoro-2-(4-iodo-3-methylanilino)benzamide.
| Compound Name | 5-[bis(pyridin-3-ylmethyl)sulfamoyl]-N-(cyclopropylmethoxy)-3,4-difluoro-2-(4-iodo-3-methylanilino)benzamide |
|---|---|
| PubChem CID | 142653793 |
| Molecular Formula | C30H28F2IN5O4S |
| Molecular Weight | 719.55 g/mol |
| Exact Mass | 719.09 |
| IUPAC Name | 5-[bis(pyridin-3-ylmethyl)sulfamoyl]-N-(cyclopropylmethoxy)-3,4-difluoro-2-(4-iodo-3-methylanilino)benzamide |
| SMILES | Cc1cc(Nc2c(C(=O)NOCC3CC3)cc(S(=O)(=O)N(Cc3cccnc3)Cc3cccnc3)c(F)c2F)ccc1I |
| InChI | InChI=1S/C30H28F2IN5O4S/c1-19-12-23(8-9-25(19)33)36-29-24(30(39)37-42-18-20-6-7-20)13-26(27(31)28(29)32)43(40,41)38(16-21-4-2-10-34-14-21)17-22-5-3-11-35-15-22/h2-5,8-15,20,36H,6-7,16-18H2,1H3,(H,37,39) |
| InChIKey | UWBAPBZLUNWPRU-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.55 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|