C27H28ClF2IN4O4S — CID 22707308
5-[benzyl-[2-(dimethylamino)ethyl]sulfamoyl]-2-(2-chloro-4-iodoanilino)-3,4-difluoro-N-prop-2-enoxybenzamide (PubChem CID 22707308) has the molecular formula C27H28ClF2IN4O4S and a molecular weight of 704.97 g/mol. Its IUPAC name is 5-[benzyl-[2-(dimethylamino)ethyl]sulfamoyl]-2-(2-chloro-4-iodoanilino)-3,4-difluoro-N-prop-2-enoxybenzamide.
| Compound Name | 5-[benzyl-[2-(dimethylamino)ethyl]sulfamoyl]-2-(2-chloro-4-iodoanilino)-3,4-difluoro-N-prop-2-enoxybenzamide |
|---|---|
| PubChem CID | 22707308 |
| Molecular Formula | C27H28ClF2IN4O4S |
| Molecular Weight | 704.97 g/mol |
| Exact Mass | 704.05 |
| IUPAC Name | 5-[benzyl-[2-(dimethylamino)ethyl]sulfamoyl]-2-(2-chloro-4-iodoanilino)-3,4-difluoro-N-prop-2-enoxybenzamide |
| SMILES | C=CCONC(=O)c1cc(S(=O)(=O)N(CCN(C)C)Cc2ccccc2)c(F)c(F)c1Nc1ccc(I)cc1Cl |
| InChI | InChI=1S/C27H28ClF2IN4O4S/c1-4-14-39-33-27(36)20-16-23(24(29)25(30)26(20)32-22-11-10-19(31)15-21(22)28)40(37,38)35(13-12-34(2)3)17-18-8-6-5-7-9-18/h4-11,15-16,32H,1,12-14,17H2,2-3H3,(H,33,36) |
| InChIKey | PZJFJVLJGGCFAJ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.97 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|