C26H26ClF2IN4O5S — CID 22707228
2-(2-chloro-4-iodoanilino)-N-(cyclopropylmethoxy)-3,4-difluoro-5-[3-hydroxypropyl(pyridin-4-ylmethyl)sulfamoyl]benzamide (PubChem CID 22707228) has the molecular formula C26H26ClF2IN4O5S and a molecular weight of 706.94 g/mol. Its IUPAC name is 2-(2-chloro-4-iodoanilino)-N-(cyclopropylmethoxy)-3,4-difluoro-5-[3-hydroxypropyl(pyridin-4-ylmethyl)sulfamoyl]benzamide.
| Compound Name | 2-(2-chloro-4-iodoanilino)-N-(cyclopropylmethoxy)-3,4-difluoro-5-[3-hydroxypropyl(pyridin-4-ylmethyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 22707228 |
| Molecular Formula | C26H26ClF2IN4O5S |
| Molecular Weight | 706.94 g/mol |
| Exact Mass | 706.03 |
| IUPAC Name | 2-(2-chloro-4-iodoanilino)-N-(cyclopropylmethoxy)-3,4-difluoro-5-[3-hydroxypropyl(pyridin-4-ylmethyl)sulfamoyl]benzamide |
| SMILES | O=C(NOCC1CC1)c1cc(S(=O)(=O)N(CCCO)Cc2ccncc2)c(F)c(F)c1Nc1ccc(I)cc1Cl |
| InChI | InChI=1S/C26H26ClF2IN4O5S/c27-20-12-18(30)4-5-21(20)32-25-19(26(36)33-39-15-17-2-3-17)13-22(23(28)24(25)29)40(37,38)34(10-1-11-35)14-16-6-8-31-9-7-16/h4-9,12-13,17,32,35H,1-3,10-11,14-15H2,(H,33,36) |
| InChIKey | OXLHETDMSIHRST-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 120.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.94 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|