C27H29F2IN4O5S — CID 87966464
N-(cyclopropylmethoxy)-3,4-difluoro-5-[(4-hydroxy-1-pyridin-2-ylbutyl)sulfamoyl]-2-(4-iodo-2-methylanilino)benzamide (PubChem CID 87966464) has the molecular formula C27H29F2IN4O5S and a molecular weight of 686.52 g/mol. Its IUPAC name is N-(cyclopropylmethoxy)-3,4-difluoro-5-[(4-hydroxy-1-pyridin-2-ylbutyl)sulfamoyl]-2-(4-iodo-2-methylanilino)benzamide.
| Compound Name | N-(cyclopropylmethoxy)-3,4-difluoro-5-[(4-hydroxy-1-pyridin-2-ylbutyl)sulfamoyl]-2-(4-iodo-2-methylanilino)benzamide |
|---|---|
| PubChem CID | 87966464 |
| Molecular Formula | C27H29F2IN4O5S |
| Molecular Weight | 686.52 g/mol |
| Exact Mass | 686.09 |
| IUPAC Name | N-(cyclopropylmethoxy)-3,4-difluoro-5-[(4-hydroxy-1-pyridin-2-ylbutyl)sulfamoyl]-2-(4-iodo-2-methylanilino)benzamide |
| SMILES | Cc1cc(I)ccc1Nc1c(C(=O)NOCC2CC2)cc(S(=O)(=O)NC(CCCO)c2ccccn2)c(F)c1F |
| InChI | InChI=1S/C27H29F2IN4O5S/c1-16-13-18(30)9-10-20(16)32-26-19(27(36)33-39-15-17-7-8-17)14-23(24(28)25(26)29)40(37,38)34-22(6-4-12-35)21-5-2-3-11-31-21/h2-3,5,9-11,13-14,17,22,32,34-35H,4,6-8,12,15H2,1H3,(H,33,36) |
| InChIKey | HIYCNGROQROWSN-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 129.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.52 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|