C26H27F2IN4O5S — CID 22707279
N-(cyclopropylmethoxy)-3,4-difluoro-5-[3-hydroxypropyl(pyridin-2-ylmethyl)sulfamoyl]-2-(4-iodoanilino)benzamide (PubChem CID 22707279) has the molecular formula C26H27F2IN4O5S and a molecular weight of 672.49 g/mol. Its IUPAC name is N-(cyclopropylmethoxy)-3,4-difluoro-5-[3-hydroxypropyl(pyridin-2-ylmethyl)sulfamoyl]-2-(4-iodoanilino)benzamide.
| Compound Name | N-(cyclopropylmethoxy)-3,4-difluoro-5-[3-hydroxypropyl(pyridin-2-ylmethyl)sulfamoyl]-2-(4-iodoanilino)benzamide |
|---|---|
| PubChem CID | 22707279 |
| Molecular Formula | C26H27F2IN4O5S |
| Molecular Weight | 672.49 g/mol |
| Exact Mass | 672.07 |
| IUPAC Name | N-(cyclopropylmethoxy)-3,4-difluoro-5-[3-hydroxypropyl(pyridin-2-ylmethyl)sulfamoyl]-2-(4-iodoanilino)benzamide |
| SMILES | O=C(NOCC1CC1)c1cc(S(=O)(=O)N(CCCO)Cc2ccccn2)c(F)c(F)c1Nc1ccc(I)cc1 |
| InChI | InChI=1S/C26H27F2IN4O5S/c27-23-22(39(36,37)33(12-3-13-34)15-20-4-1-2-11-30-20)14-21(26(35)32-38-16-17-5-6-17)25(24(23)28)31-19-9-7-18(29)8-10-19/h1-2,4,7-11,14,17,31,34H,3,5-6,12-13,15-16H2,(H,32,35) |
| InChIKey | GSKUNKPKLFYCMH-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 120.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.49 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|