C21H19ClIN3O2 — CID 139878859
5-chloro-N-(cyclopropylmethoxy)-2-(4-iodoanilino)-4-pyrrol-1-ylbenzamide (PubChem CID 139878859) has the molecular formula C21H19ClIN3O2 and a molecular weight of 507.76 g/mol. Its IUPAC name is 5-chloro-N-(cyclopropylmethoxy)-2-(4-iodoanilino)-4-pyrrol-1-ylbenzamide.
| Compound Name | 5-chloro-N-(cyclopropylmethoxy)-2-(4-iodoanilino)-4-pyrrol-1-ylbenzamide |
|---|---|
| PubChem CID | 139878859 |
| Molecular Formula | C21H19ClIN3O2 |
| Molecular Weight | 507.76 g/mol |
| Exact Mass | 507.02 |
| IUPAC Name | 5-chloro-N-(cyclopropylmethoxy)-2-(4-iodoanilino)-4-pyrrol-1-ylbenzamide |
| SMILES | O=C(NOCC1CC1)c1cc(Cl)c(-n2cccc2)cc1Nc1ccc(I)cc1 |
| InChI | InChI=1S/C21H19ClIN3O2/c22-18-11-17(21(27)25-28-13-14-3-4-14)19(12-20(18)26-9-1-2-10-26)24-16-7-5-15(23)6-8-16/h1-2,5-12,14,24H,3-4,13H2,(H,25,27) |
| InChIKey | FRVAKSLQIABKMV-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.76 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|