2-(4-iodoanilino)-4-nitro-5-pyrrol-1-ylbenzoic acid

C17H12IN3O4 — CID 139878782

IUPAC2-(4-iodoanilino)-4-nitro-5-pyrrol-1-ylbenzoic acid
SMILESO=C(O)c1cc(-n2cccc2)c([N+](=O)[O-])cc1Nc1ccc(I)cc1
InChIInChI=1S/C17H12IN3O4/c18-11-3-5-12(6-4-11)19-14-10-16(21(24)25)15(9-13(14)17(22)23)20-7-1-2-8-20/h1-10,19H,(H,22,23)
InChIKeyXHBCYXMWVYXUFQ-UHFFFAOYSA-N
MW449.20 g/mol
LogP4.43
Rot. Bonds5

About 2-(4-iodoanilino)-4-nitro-5-pyrrol-1-ylbenzoic acid

2-(4-iodoanilino)-4-nitro-5-pyrrol-1-ylbenzoic acid (PubChem CID 139878782) has the molecular formula C17H12IN3O4 and a molecular weight of 449.20 g/mol. Its IUPAC name is 2-(4-iodoanilino)-4-nitro-5-pyrrol-1-ylbenzoic acid.

Molecular Properties

Compound Name2-(4-iodoanilino)-4-nitro-5-pyrrol-1-ylbenzoic acid
PubChem CID139878782
Molecular FormulaC17H12IN3O4
Molecular Weight449.20 g/mol
Exact Mass448.99
IUPAC Name2-(4-iodoanilino)-4-nitro-5-pyrrol-1-ylbenzoic acid
SMILESO=C(O)c1cc(-n2cccc2)c([N+](=O)[O-])cc1Nc1ccc(I)cc1
InChIInChI=1S/C17H12IN3O4/c18-11-3-5-12(6-4-11)19-14-10-16(21(24)25)15(9-13(14)17(22)23)20-7-1-2-8-20/h1-10,19H,(H,22,23)
InChIKeyXHBCYXMWVYXUFQ-UHFFFAOYSA-N
XLogP4.43
TPSA97.40 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms25
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500449.20
LogP ≤ 54.43
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2-(4-iodoanilino)-4-nitro-5-pyrrol-1-ylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4-iodoanilino)-4-nitro-5-pyrrol-1-ylbenzoic acid?
The IUPAC name of 2-(4-iodoanilino)-4-nitro-5-pyrrol-1-ylbenzoic acid (CID 139878782) is 2-(4-iodoanilino)-4-nitro-5-pyrrol-1-ylbenzoic acid.
What is the SMILES notation for 2-(4-iodoanilino)-4-nitro-5-pyrrol-1-ylbenzoic acid?
The canonical SMILES for 2-(4-iodoanilino)-4-nitro-5-pyrrol-1-ylbenzoic acid is O=C(O)c1cc(-n2cccc2)c([N+](=O)[O-])cc1Nc1ccc(I)cc1.
What is the InChIKey of 2-(4-iodoanilino)-4-nitro-5-pyrrol-1-ylbenzoic acid?
The InChIKey is XHBCYXMWVYXUFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12IN3O4/c18-11-3-5-12(6-4-11)19-14-10-16(21(24)25)15(9-13(14)17(22)23)20-7-1-2-8-20/h1-10,19H,(H,22,23).
What are the key properties of 2-(4-iodoanilino)-4-nitro-5-pyrrol-1-ylbenzoic acid?
2-(4-iodoanilino)-4-nitro-5-pyrrol-1-ylbenzoic acid has a molecular weight of 449.20 g/mol, XLogP of 4.43, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-iodoanilino)-4-nitro-5-pyrrol-1-ylbenzoic acid is sourced from PubChem (CID 139878782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).