C13H10IN3O7 — CID 139198723
2-carboxy-4,6-dinitrophenolate;(4-iodophenyl)azanium (PubChem CID 139198723) has the molecular formula C13H10IN3O7 and a molecular weight of 447.14 g/mol. Its IUPAC name is 2-carboxy-4,6-dinitrophenolate;(4-iodophenyl)azanium.
| Compound Name | 2-carboxy-4,6-dinitrophenolate;(4-iodophenyl)azanium |
|---|---|
| PubChem CID | 139198723 |
| Molecular Formula | C13H10IN3O7 |
| Molecular Weight | 447.14 g/mol |
| Exact Mass | 446.96 |
| IUPAC Name | 2-carboxy-4,6-dinitrophenolate;(4-iodophenyl)azanium |
| SMILES | O=C(O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1[O-].[NH3+]c1ccc(I)cc1 |
| InChI | InChI=1S/C7H4N2O7.C6H6IN/c10-6-4(7(11)12)1-3(8(13)14)2-5(6)9(15)16;7-5-1-3-6(8)4-2-5/h1-2,10H,(H,11,12);1-4H,8H2 |
| InChIKey | ILMLUHRVNOMDAI-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 174.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.14 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|