C10H10N8O7 — CID 139044271
2-carboxy-4,6-dinitrophenolate;1,3,5-triazin-1-ium-2,4,6-triamine (PubChem CID 139044271) has the molecular formula C10H10N8O7 and a molecular weight of 354.24 g/mol. Its IUPAC name is 2-carboxy-4,6-dinitrophenolate;1,3,5-triazin-1-ium-2,4,6-triamine.
| Compound Name | 2-carboxy-4,6-dinitrophenolate;1,3,5-triazin-1-ium-2,4,6-triamine |
|---|---|
| PubChem CID | 139044271 |
| Molecular Formula | C10H10N8O7 |
| Molecular Weight | 354.24 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | 2-carboxy-4,6-dinitrophenolate;1,3,5-triazin-1-ium-2,4,6-triamine |
| SMILES | Nc1nc(N)[nH+]c(N)n1.O=C(O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1[O-] |
| InChI | InChI=1S/C7H4N2O7.C3H6N6/c10-6-4(7(11)12)1-3(8(13)14)2-5(6)9(15)16;4-1-7-2(5)9-3(6)8-1/h1-2,10H,(H,11,12);(H6,4,5,6,7,8,9) |
| InChIKey | JCAVZVQGIXSEQQ-UHFFFAOYSA-N |
| XLogP | -1.69 |
| TPSA | 264.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.24 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|