C7H3N3O8 — CID 8518
2,4,6-trinitrobenzoic acid (PubChem CID 8518) has the molecular formula C7H3N3O8 and a molecular weight of 257.11 g/mol. Its IUPAC name is 2,4,6-trinitrobenzoic acid.
| Compound Name | 2,4,6-trinitrobenzoic acid |
|---|---|
| PubChem CID | 8518 |
| Molecular Formula | C7H3N3O8 |
| Molecular Weight | 257.11 g/mol |
| Exact Mass | 256.99 |
| IUPAC Name | 2,4,6-trinitrobenzoic acid |
| SMILES | O=C(O)c1c([N+](=O)[O-])cc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H3N3O8/c11-7(12)6-4(9(15)16)1-3(8(13)14)2-5(6)10(17)18/h1-2H,(H,11,12) |
| InChIKey | KAQBNBSMMVTKRN-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 166.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.11 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|