C7H6N4O8 — CID 173315139
azane;2,4,6-trinitrobenzoic acid (PubChem CID 173315139) has the molecular formula C7H6N4O8 and a molecular weight of 274.15 g/mol. Its IUPAC name is azane;2,4,6-trinitrobenzoic acid.
| Compound Name | azane;2,4,6-trinitrobenzoic acid |
|---|---|
| PubChem CID | 173315139 |
| Molecular Formula | C7H6N4O8 |
| Molecular Weight | 274.15 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | azane;2,4,6-trinitrobenzoic acid |
| SMILES | N.O=C(O)c1c([N+](=O)[O-])cc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H3N3O8.H3N/c11-7(12)6-4(9(15)16)1-3(8(13)14)2-5(6)10(17)18;/h1-2H,(H,11,12);1H3 |
| InChIKey | JUAOCJDQSDVBGK-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 201.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.15 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|