C9H7N3O7 — CID 88762705
(2-methyl-4,6-dinitrobenzoyl)carbamic acid (PubChem CID 88762705) has the molecular formula C9H7N3O7 and a molecular weight of 269.17 g/mol. Its IUPAC name is (2-methyl-4,6-dinitrobenzoyl)carbamic acid.
| Compound Name | (2-methyl-4,6-dinitrobenzoyl)carbamic acid |
|---|---|
| PubChem CID | 88762705 |
| Molecular Formula | C9H7N3O7 |
| Molecular Weight | 269.17 g/mol |
| Exact Mass | 269.03 |
| IUPAC Name | (2-methyl-4,6-dinitrobenzoyl)carbamic acid |
| SMILES | Cc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1C(=O)NC(=O)O |
| InChI | InChI=1S/C9H7N3O7/c1-4-2-5(11(16)17)3-6(12(18)19)7(4)8(13)10-9(14)15/h2-3H,1H3,(H,10,13)(H,14,15) |
| InChIKey | ZGEHSUTYBGRHQX-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 152.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.17 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|