C27H28N4O6 — CID 176910821
N-[3-[(2,6-dimethyl-4-nitrobenzoyl)amino]-2,4,6-trimethylphenyl]-2,6-dimethyl-4-nitrobenzamide (PubChem CID 176910821) has the molecular formula C27H28N4O6 and a molecular weight of 504.54 g/mol. Its IUPAC name is N-[3-[(2,6-dimethyl-4-nitrobenzoyl)amino]-2,4,6-trimethylphenyl]-2,6-dimethyl-4-nitrobenzamide.
| Compound Name | N-[3-[(2,6-dimethyl-4-nitrobenzoyl)amino]-2,4,6-trimethylphenyl]-2,6-dimethyl-4-nitrobenzamide |
|---|---|
| PubChem CID | 176910821 |
| Molecular Formula | C27H28N4O6 |
| Molecular Weight | 504.54 g/mol |
| Exact Mass | 504.20 |
| IUPAC Name | N-[3-[(2,6-dimethyl-4-nitrobenzoyl)amino]-2,4,6-trimethylphenyl]-2,6-dimethyl-4-nitrobenzamide |
| SMILES | Cc1cc(C)c(NC(=O)c2c(C)cc([N+](=O)[O-])cc2C)c(C)c1NC(=O)c1c(C)cc([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C27H28N4O6/c1-13-9-20(30(34)35)10-14(2)22(13)26(32)28-24-17(5)8-18(6)25(19(24)7)29-27(33)23-15(3)11-21(31(36)37)12-16(23)4/h8-12H,1-7H3,(H,28,32)(H,29,33) |
| InChIKey | LUUXZWFFBRDWEK-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 144.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.54 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|