C12H11N3O3S — CID 71857584
N-(2,6-dimethyl-4-nitrophenyl)-1,3-thiazole-4-carboxamide (PubChem CID 71857584) has the molecular formula C12H11N3O3S and a molecular weight of 277.31 g/mol. Its IUPAC name is N-(2,6-dimethyl-4-nitrophenyl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-(2,6-dimethyl-4-nitrophenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 71857584 |
| Molecular Formula | C12H11N3O3S |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | N-(2,6-dimethyl-4-nitrophenyl)-1,3-thiazole-4-carboxamide |
| SMILES | Cc1cc([N+](=O)[O-])cc(C)c1NC(=O)c1cscn1 |
| InChI | InChI=1S/C12H11N3O3S/c1-7-3-9(15(17)18)4-8(2)11(7)14-12(16)10-5-19-6-13-10/h3-6H,1-2H3,(H,14,16) |
| InChIKey | ABQFJQPJBVZUGY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|